3-AZASPIRO[5.5]UNDECANE
3-Azaspiro[5.5]undecane
CAS: 180-44-9
Molecular Formula: C10H19N
3-AZASPIRO[5.5]UNDECANE - Names and Identifiers
| Name | 3-Azaspiro[5.5]undecane |
| Synonyms | 3-Azaspiro[5.5]undecane 3-AZASPIRO[5.5]UNDECANE 4,4-Pentamethylenepiperidine hydrochloride 3-Azaspiro[5.5]undecane hydrochloride salt |
| CAS | 180-44-9 |
| EINECS | 214-404-1 |
| InChI | InChI=1/C10H19N/c1-2-4-10(5-3-1)6-8-11-9-7-10/h11H,1-9H2 |
3-AZASPIRO[5.5]UNDECANE - Physico-chemical Properties
| Molecular Formula | C10H19N |
| Molar Mass | 153.26 |
| Density | 0.93±0.1 g/cm3(Predicted) |
| Boling Point | 223.2±8.0 °C(Predicted) |
| Flash Point | 86.7°C |
| Vapor Presure | 0.0973mmHg at 25°C |
| Appearance | White solid. |
| pKa | 11.17±0.20(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,2-8°C |
| Refractive Index | 1.494 |
3-AZASPIRO[5.5]UNDECANE - Introduction
3-Azaspiro[5.5]undecane is an organic compound with the chemical formula C11H20N. It has some of the following properties:
1. Structural stability: because its molecule contains nitrogen Spiro ring structure, its molecular structure is relatively stable.
2. Thermal stability: 3-Azaspiro[5.5]undecane has high thermal stability and can maintain structural integrity under high temperature conditions.
3. Smaller density: Its molecules have a smaller density and can be used at lower concentrations.
4. Solubility: It can be well dissolved in regular organic solvents, such as ethanol, acetone, etc.
3-Azaspiro[5.5]undecane can be applied to the following aspects under certain conditions:
1. Thermodynamic stabilizer: Due to the stability of its molecular structure, it can be used as a thermodynamic stabilizer to protect the stability of other compounds under high temperature conditions.
2. Default diastereoselective catalyst: It can be used as an Enantioselective Catalyst to produce specific chemical products in organic synthesis reactions.
3. Liquid crystal material: Due to the particularity of its molecular structure, 3-Azaspiro[5.5]undecane can be used in the manufacture of liquid crystal displays.
One way to make 3-Azaspiro[5.5]undecane is through chemical synthesis. Specific methods include synthesis by appropriate chemical reactions or using intermediates in the synthetic route.
When using or handling 3-Azaspiro[5.5]undecane, you need to pay attention to the following safety information:
1. Avoid inhalation and Contact: Avoid inhalation of its vapor or gas, and avoid direct contact with the substance.
2. Use protective measures: When handling this compound, wear appropriate personal protective equipment, such as chemical protective gloves, goggles, etc.
3. Storage precautions: it should be stored in a dry, cool place, and avoid contact with oxidants and other substances.
4. Waste disposal: it is necessary to carry out correct waste disposal in accordance with local laws and regulations to reduce the impact on the environment.
It should be noted that the above information is for reference only. Please refer to the specific chemical substance Safety Data Sheet (MSDS) and operating procedures when using or handling 3-Azaspiro[5.5]undecane.
1. Structural stability: because its molecule contains nitrogen Spiro ring structure, its molecular structure is relatively stable.
2. Thermal stability: 3-Azaspiro[5.5]undecane has high thermal stability and can maintain structural integrity under high temperature conditions.
3. Smaller density: Its molecules have a smaller density and can be used at lower concentrations.
4. Solubility: It can be well dissolved in regular organic solvents, such as ethanol, acetone, etc.
3-Azaspiro[5.5]undecane can be applied to the following aspects under certain conditions:
1. Thermodynamic stabilizer: Due to the stability of its molecular structure, it can be used as a thermodynamic stabilizer to protect the stability of other compounds under high temperature conditions.
2. Default diastereoselective catalyst: It can be used as an Enantioselective Catalyst to produce specific chemical products in organic synthesis reactions.
3. Liquid crystal material: Due to the particularity of its molecular structure, 3-Azaspiro[5.5]undecane can be used in the manufacture of liquid crystal displays.
One way to make 3-Azaspiro[5.5]undecane is through chemical synthesis. Specific methods include synthesis by appropriate chemical reactions or using intermediates in the synthetic route.
When using or handling 3-Azaspiro[5.5]undecane, you need to pay attention to the following safety information:
1. Avoid inhalation and Contact: Avoid inhalation of its vapor or gas, and avoid direct contact with the substance.
2. Use protective measures: When handling this compound, wear appropriate personal protective equipment, such as chemical protective gloves, goggles, etc.
3. Storage precautions: it should be stored in a dry, cool place, and avoid contact with oxidants and other substances.
4. Waste disposal: it is necessary to carry out correct waste disposal in accordance with local laws and regulations to reduce the impact on the environment.
It should be noted that the above information is for reference only. Please refer to the specific chemical substance Safety Data Sheet (MSDS) and operating procedures when using or handling 3-Azaspiro[5.5]undecane.
Last Update：2024-04-10 22:29:15
![3-AZASPIRO[5.5]UNDECANE](http://res.chembk.com/assets/str/2d/1/18/180-44-9.png)
Supplier List
Product Name: 3-AZASPIRO[5.5]UNDECANE Visit Supplier Webpage Request for quotation
CAS: 180-44-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 180-44-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 3-AZASPIRO[5.5]UNDECANE Visit Supplier Webpage Request for quotation
CAS: 180-44-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 180-44-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History